Chuyên mục Ổ đĩa cứng SSD intel
TÌM KIẾM
Tặng 50.000 đ (KT 7/3) 180GB Intel SSDSC2KF180H6X1(180/5400Pro)
Đặt mua Quan tâm So sánh
Đặt mua Quan tâm So sánh
Đặt mua Quan tâm So sánh
Đặt mua Quan tâm So sánh
Đặt mua Quan tâm So sánh
Đặt mua Quan tâm So sánh
Đặt mua Quan tâm So sánh